About 3-propan-2-yl-3a,4,5,6-tetrahydrocyclopenta[c]pyrrole
3-propan-2-yl-3a,4,5,6-tetrahydrocyclopenta[c]pyrrole (PubChem CID 88981468) has the molecular formula C10H15N
and a molecular weight of 149.24 g/mol. Its IUPAC name is 3-propan-2-yl-3a,4,5,6-tetrahydrocyclopenta[c]pyrrole.
Analyze 3-propan-2-yl-3a,4,5,6-tetrahydrocyclopenta[c]pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-propan-2-yl-3a,4,5,6-tetrahydrocyclopenta[c]pyrrole?
The IUPAC name of 3-propan-2-yl-3a,4,5,6-tetrahydrocyclopenta[c]pyrrole (CID 88981468) is 3-propan-2-yl-3a,4,5,6-tetrahydrocyclopenta[c]pyrrole.
What is the SMILES notation for 3-propan-2-yl-3a,4,5,6-tetrahydrocyclopenta[c]pyrrole?
The canonical SMILES for 3-propan-2-yl-3a,4,5,6-tetrahydrocyclopenta[c]pyrrole is CC(C)C1=NC=C2CCCC21.
What is the InChIKey of 3-propan-2-yl-3a,4,5,6-tetrahydrocyclopenta[c]pyrrole?
The InChIKey is DWSUMZJDBMOXKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N/c1-7(2)10-9-5-3-4-8(9)6-11-10/h6-7,9H,3-5H2,1-2H3.
What are the key properties of 3-propan-2-yl-3a,4,5,6-tetrahydrocyclopenta[c]pyrrole?
3-propan-2-yl-3a,4,5,6-tetrahydrocyclopenta[c]pyrrole has a molecular weight of 149.24 g/mol, XLogP of 2.78, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-propan-2-yl-3a,4,5,6-tetrahydrocyclopenta[c]pyrrole is sourced from PubChem (CID 88981468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).