C21H21FN2O5S — CID 88981488
2-(4-fluorophenyl)-N-methoxy-9-methylsulfonyl-5,6,7,8-tetrahydrofuro[3,2-h][1]benzazepine-3-carboxamide (PubChem CID 88981488) has the molecular formula C21H21FN2O5S and a molecular weight of 432.47 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-N-methoxy-9-methylsulfonyl-5,6,7,8-tetrahydrofuro[3,2-h][1]benzazepine-3-carboxamide.
| Compound Name | 2-(4-fluorophenyl)-N-methoxy-9-methylsulfonyl-5,6,7,8-tetrahydrofuro[3,2-h][1]benzazepine-3-carboxamide |
|---|---|
| PubChem CID | 88981488 |
| Molecular Formula | C21H21FN2O5S |
| Molecular Weight | 432.47 g/mol |
| Exact Mass | 432.12 |
| IUPAC Name | 2-(4-fluorophenyl)-N-methoxy-9-methylsulfonyl-5,6,7,8-tetrahydrofuro[3,2-h][1]benzazepine-3-carboxamide |
| SMILES | CONC(=O)c1c(-c2ccc(F)cc2)oc2cc3c(cc12)CCCCN3S(C)(=O)=O |
| InChI | InChI=1S/C21H21FN2O5S/c1-28-23-21(25)19-16-11-14-5-3-4-10-24(30(2,26)27)17(14)12-18(16)29-20(19)13-6-8-15(22)9-7-13/h6-9,11-12H,3-5,10H2,1-2H3,(H,23,25) |
| InChIKey | YKALMWGCCMHDQF-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.47 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|