C23H27BrClFN2O2 — CID 88981778
N-[[(2R,4aS,5S,10bS)-9-bromo-5-cyclohexa-2,4-dien-1-yl-7-fluoro-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-4-chlorobutanamide (PubChem CID 88981778) has the molecular formula C23H27BrClFN2O2 and a molecular weight of 497.84 g/mol. Its IUPAC name is N-[[(2R,4aS,5S,10bS)-9-bromo-5-cyclohexa-2,4-dien-1-yl-7-fluoro-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-4-chlorobutanamide.
| Compound Name | N-[[(2R,4aS,5S,10bS)-9-bromo-5-cyclohexa-2,4-dien-1-yl-7-fluoro-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-4-chlorobutanamide |
|---|---|
| PubChem CID | 88981778 |
| Molecular Formula | C23H27BrClFN2O2 |
| Molecular Weight | 497.84 g/mol |
| Exact Mass | 496.09 |
| IUPAC Name | N-[[(2R,4aS,5S,10bS)-9-bromo-5-cyclohexa-2,4-dien-1-yl-7-fluoro-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-4-chlorobutanamide |
| SMILES | O=C(CCCCl)NC[C@H]1CC[C@@H]2[C@H](O1)c1cc(Br)cc(F)c1N[C@H]2C1C=CC=CC1 |
| InChI | InChI=1S/C23H27BrClFN2O2/c24-15-11-18-22(19(26)12-15)28-21(14-5-2-1-3-6-14)17-9-8-16(30-23(17)18)13-27-20(29)7-4-10-25/h1-3,5,11-12,14,16-17,21,23,28H,4,6-10,13H2,(H,27,29)/t14?,16-,17+,21+,23+/m1/s1 |
| InChIKey | MHMQUBWOJPCEFN-LXXTVXBZSA-N |
| XLogP | 5.49 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.84 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|