C12H14BN3O2 — CID 88981815
CID 88981815 (PubChem CID 88981815) has the molecular formula C12H14BN3O2 and a molecular weight of 243.07 g/mol.
| Compound Name | CID 88981815 |
|---|---|
| PubChem CID | 88981815 |
| Molecular Formula | C12H14BN3O2 |
| Molecular Weight | 243.07 g/mol |
| Exact Mass | 243.12 |
| IUPAC Name | — |
| SMILES | [B]c1cnc2c(c1)[nH]c(=O)n2C1CCCC(O)C1 |
| InChI | InChI=1S/C12H14BN3O2/c13-7-4-10-11(14-6-7)16(12(18)15-10)8-2-1-3-9(17)5-8/h4,6,8-9,17H,1-3,5H2,(H,15,18) |
| InChIKey | GETPHYJPFOJFCP-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 70.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.07 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|