C17H28O — CID 88981977
[(4R)-5-cyclohexyl-1-methylidene-2,3,3a,4,5,6,7,7a-octahydroinden-4-yl]methanol (PubChem CID 88981977) has the molecular formula C17H28O and a molecular weight of 248.41 g/mol. Its IUPAC name is [(4R)-5-cyclohexyl-1-methylidene-2,3,3a,4,5,6,7,7a-octahydroinden-4-yl]methanol.
| Compound Name | [(4R)-5-cyclohexyl-1-methylidene-2,3,3a,4,5,6,7,7a-octahydroinden-4-yl]methanol |
|---|---|
| PubChem CID | 88981977 |
| Molecular Formula | C17H28O |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.21 |
| IUPAC Name | [(4R)-5-cyclohexyl-1-methylidene-2,3,3a,4,5,6,7,7a-octahydroinden-4-yl]methanol |
| SMILES | C=C1CCC2C1CCC(C1CCCCC1)[C@H]2CO |
| InChI | InChI=1S/C17H28O/c1-12-7-8-16-14(12)9-10-15(17(16)11-18)13-5-3-2-4-6-13/h13-18H,1-11H2/t14?,15?,16?,17-/m1/s1 |
| InChIKey | ADXINRFRFHLWTJ-VKFIQFPUSA-N |
| XLogP | 4.17 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|