C23H39NO2 — CID 88981978
cis-(1S,3S)-4-[(4R,7aS)-4-(hydroxymethyl)-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl]-3-(pyrrolidin-1-ylmethyl)cyclohexan-1-ol (PubChem CID 88981978) has the molecular formula C23H39NO2 and a molecular weight of 361.57 g/mol. Its IUPAC name is cis-(1S,3S)-4-[(4R,7aS)-4-(hydroxymethyl)-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl]-3-(pyrrolidin-1-ylmethyl)cyclohexan-1-ol.
| Compound Name | cis-(1S,3S)-4-[(4R,7aS)-4-(hydroxymethyl)-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl]-3-(pyrrolidin-1-ylmethyl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 88981978 |
| Molecular Formula | C23H39NO2 |
| Molecular Weight | 361.57 g/mol |
| Exact Mass | 361.30 |
| IUPAC Name | cis-(1S,3S)-4-[(4R,7aS)-4-(hydroxymethyl)-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl]-3-(pyrrolidin-1-ylmethyl)cyclohexan-1-ol |
| SMILES | C=C1CCC2[C@H](CO)C(C3CC[C@H](O)C[C@@H]3CN3CCCC3)CC[C@]12C |
| InChI | InChI=1S/C23H39NO2/c1-16-5-8-22-21(15-25)20(9-10-23(16,22)2)19-7-6-18(26)13-17(19)14-24-11-3-4-12-24/h17-22,25-26H,1,3-15H2,2H3/t17-,18+,19?,20?,21-,22?,23-/m1/s1 |
| InChIKey | LPHDRDIEIAEERZ-HPBIJLGTSA-N |
| XLogP | 3.85 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.57 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|