About (E)-8-(2-methoxyprop-2-enoxy)-4,8-dimethylnon-3-ene
(E)-8-(2-methoxyprop-2-enoxy)-4,8-dimethylnon-3-ene (PubChem CID 88982026) has the molecular formula C15H28O2
and a molecular weight of 240.39 g/mol. Its IUPAC name is (E)-8-(2-methoxyprop-2-enoxy)-4,8-dimethylnon-3-ene.
Molecular Properties
| Compound Name | (E)-8-(2-methoxyprop-2-enoxy)-4,8-dimethylnon-3-ene |
| PubChem CID | 88982026 |
| Molecular Formula | C15H28O2 |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.21 |
| IUPAC Name | (E)-8-(2-methoxyprop-2-enoxy)-4,8-dimethylnon-3-ene |
| SMILES | C=C(COC(C)(C)CCC/C(C)=C/CC)OC |
| InChI | InChI=1S/C15H28O2/c1-7-9-13(2)10-8-11-15(4,5)17-12-14(3)16-6/h9H,3,7-8,10-12H2,1-2,4-6H3/b13-9+ |
| InChIKey | WWHAJSFVZGVEFI-UKTHLTGXSA-N |
| XLogP | 4.47 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-8-(2-methoxyprop-2-enoxy)-4,8-dimethylnon-3-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-8-(2-methoxyprop-2-enoxy)-4,8-dimethylnon-3-ene?
The IUPAC name of (E)-8-(2-methoxyprop-2-enoxy)-4,8-dimethylnon-3-ene (CID 88982026) is (E)-8-(2-methoxyprop-2-enoxy)-4,8-dimethylnon-3-ene.
What is the SMILES notation for (E)-8-(2-methoxyprop-2-enoxy)-4,8-dimethylnon-3-ene?
The canonical SMILES for (E)-8-(2-methoxyprop-2-enoxy)-4,8-dimethylnon-3-ene is C=C(COC(C)(C)CCC/C(C)=C/CC)OC.
What is the InChIKey of (E)-8-(2-methoxyprop-2-enoxy)-4,8-dimethylnon-3-ene?
The InChIKey is WWHAJSFVZGVEFI-UKTHLTGXSA-N. The full InChI is InChI=1S/C15H28O2/c1-7-9-13(2)10-8-11-15(4,5)17-12-14(3)16-6/h9H,3,7-8,10-12H2,1-2,4-6H3/b13-9+.
What are the key properties of (E)-8-(2-methoxyprop-2-enoxy)-4,8-dimethylnon-3-ene?
(E)-8-(2-methoxyprop-2-enoxy)-4,8-dimethylnon-3-ene has a molecular weight of 240.39 g/mol, XLogP of 4.47, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-8-(2-methoxyprop-2-enoxy)-4,8-dimethylnon-3-ene is sourced from PubChem (CID 88982026), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).