About (3Z)-5-iminohepta-3,6-dien-2-one
(3Z)-5-iminohepta-3,6-dien-2-one (PubChem CID 88982078) has the molecular formula C7H9NO
and a molecular weight of 123.15 g/mol. Its IUPAC name is (3Z)-5-iminohepta-3,6-dien-2-one.
Molecular Properties
| Compound Name | (3Z)-5-iminohepta-3,6-dien-2-one |
| PubChem CID | 88982078 |
| Molecular Formula | C7H9NO |
| Molecular Weight | 123.15 g/mol |
| Exact Mass | 123.07 |
| IUPAC Name | (3Z)-5-iminohepta-3,6-dien-2-one |
| SMILES | [H]/N=C(C=C)/C=C\C(C)=O |
| InChI | InChI=1S/C7H9NO/c1-3-7(8)5-4-6(2)9/h3-5,8H,1H2,2H3/b5-4-,8-7+ |
| InChIKey | WBAOMWRHORLVBY-KXKKYDSASA-N |
| XLogP | 1.34 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 123.15 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-5-iminohepta-3,6-dien-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-5-iminohepta-3,6-dien-2-one?
The IUPAC name of (3Z)-5-iminohepta-3,6-dien-2-one (CID 88982078) is (3Z)-5-iminohepta-3,6-dien-2-one.
What is the SMILES notation for (3Z)-5-iminohepta-3,6-dien-2-one?
The canonical SMILES for (3Z)-5-iminohepta-3,6-dien-2-one is [H]/N=C(C=C)/C=C\C(C)=O.
What is the InChIKey of (3Z)-5-iminohepta-3,6-dien-2-one?
The InChIKey is WBAOMWRHORLVBY-KXKKYDSASA-N. The full InChI is InChI=1S/C7H9NO/c1-3-7(8)5-4-6(2)9/h3-5,8H,1H2,2H3/b5-4-,8-7+.
What are the key properties of (3Z)-5-iminohepta-3,6-dien-2-one?
(3Z)-5-iminohepta-3,6-dien-2-one has a molecular weight of 123.15 g/mol, XLogP of 1.34, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-5-iminohepta-3,6-dien-2-one is sourced from PubChem (CID 88982078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).