C30H35NO5 — CID 88982107
[(7S,8S,11R,13S,14S,17R)-11-(4-acetamidophenyl)-17-ethenyl-17-hydroxy-13-methyl-3-oxo-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-7-yl] acetate (PubChem CID 88982107) has the molecular formula C30H35NO5 and a molecular weight of 489.61 g/mol. Its IUPAC name is [(7S,8S,11R,13S,14S,17R)-11-(4-acetamidophenyl)-17-ethenyl-17-hydroxy-13-methyl-3-oxo-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-7-yl] acetate.
| Compound Name | [(7S,8S,11R,13S,14S,17R)-11-(4-acetamidophenyl)-17-ethenyl-17-hydroxy-13-methyl-3-oxo-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-7-yl] acetate |
|---|---|
| PubChem CID | 88982107 |
| Molecular Formula | C30H35NO5 |
| Molecular Weight | 489.61 g/mol |
| Exact Mass | 489.25 |
| IUPAC Name | [(7S,8S,11R,13S,14S,17R)-11-(4-acetamidophenyl)-17-ethenyl-17-hydroxy-13-methyl-3-oxo-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-7-yl] acetate |
| SMILES | C=C[C@]1(O)CC[C@H]2[C@H]3C(=C4CCC(=O)C=C4C[C@@H]3OC(C)=O)[C@@H](c3ccc(NC(C)=O)cc3)C[C@@]21C |
| InChI | InChI=1S/C30H35NO5/c1-5-30(35)13-12-25-28-26(36-18(3)33)15-20-14-22(34)10-11-23(20)27(28)24(16-29(25,30)4)19-6-8-21(9-7-19)31-17(2)32/h5-9,14,24-26,28,35H,1,10-13,15-16H2,2-4H3,(H,31,32)/t24-,25+,26+,28-,29+,30+/m1/s1 |
| InChIKey | GOBKRPWXDANQRH-QYUJCBMPSA-N |
| XLogP | 5.00 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.61 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|