About 5,6-dimethoxy-N-methylcyclohexa-2,3,5-trien-1-imine
5,6-dimethoxy-N-methylcyclohexa-2,3,5-trien-1-imine (PubChem CID 88982129) has the molecular formula C9H11NO2
and a molecular weight of 165.19 g/mol. Its IUPAC name is 5,6-dimethoxy-N-methylcyclohexa-2,3,5-trien-1-imine.
Molecular Properties
| Compound Name | 5,6-dimethoxy-N-methylcyclohexa-2,3,5-trien-1-imine |
| PubChem CID | 88982129 |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.19 g/mol |
| Exact Mass | 165.08 |
| IUPAC Name | 5,6-dimethoxy-N-methylcyclohexa-2,3,5-trien-1-imine |
| SMILES | C/N=C1\C=C=CC(OC)=C1OC |
| InChI | InChI=1S/C9H11NO2/c1-10-7-5-4-6-8(11-2)9(7)12-3/h5-6H,1-3H3/b10-7+ |
| InChIKey | WLJLJIACEBYBOP-JXMROGBWSA-N |
| XLogP | 1.29 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.19 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 5,6-dimethoxy-N-methylcyclohexa-2,3,5-trien-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dimethoxy-N-methylcyclohexa-2,3,5-trien-1-imine?
The IUPAC name of 5,6-dimethoxy-N-methylcyclohexa-2,3,5-trien-1-imine (CID 88982129) is 5,6-dimethoxy-N-methylcyclohexa-2,3,5-trien-1-imine.
What is the SMILES notation for 5,6-dimethoxy-N-methylcyclohexa-2,3,5-trien-1-imine?
The canonical SMILES for 5,6-dimethoxy-N-methylcyclohexa-2,3,5-trien-1-imine is C/N=C1\C=C=CC(OC)=C1OC.
What is the InChIKey of 5,6-dimethoxy-N-methylcyclohexa-2,3,5-trien-1-imine?
The InChIKey is WLJLJIACEBYBOP-JXMROGBWSA-N. The full InChI is InChI=1S/C9H11NO2/c1-10-7-5-4-6-8(11-2)9(7)12-3/h5-6H,1-3H3/b10-7+.
What are the key properties of 5,6-dimethoxy-N-methylcyclohexa-2,3,5-trien-1-imine?
5,6-dimethoxy-N-methylcyclohexa-2,3,5-trien-1-imine has a molecular weight of 165.19 g/mol, XLogP of 1.29, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dimethoxy-N-methylcyclohexa-2,3,5-trien-1-imine is sourced from PubChem (CID 88982129), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).