C19H13Cl3F3N5 — CID 88982266
2-(1,2,4-triazol-1-yl)-5-[3-(3,4,5-trichlorophenyl)-3-(trifluoromethyl)-2,4-dihydropyrrol-5-yl]aniline (PubChem CID 88982266) has the molecular formula C19H13Cl3F3N5 and a molecular weight of 474.70 g/mol. Its IUPAC name is 2-(1,2,4-triazol-1-yl)-5-[3-(3,4,5-trichlorophenyl)-3-(trifluoromethyl)-2,4-dihydropyrrol-5-yl]aniline.
| Compound Name | 2-(1,2,4-triazol-1-yl)-5-[3-(3,4,5-trichlorophenyl)-3-(trifluoromethyl)-2,4-dihydropyrrol-5-yl]aniline |
|---|---|
| PubChem CID | 88982266 |
| Molecular Formula | C19H13Cl3F3N5 |
| Molecular Weight | 474.70 g/mol |
| Exact Mass | 473.02 |
| IUPAC Name | 2-(1,2,4-triazol-1-yl)-5-[3-(3,4,5-trichlorophenyl)-3-(trifluoromethyl)-2,4-dihydropyrrol-5-yl]aniline |
| SMILES | Nc1cc(C2=NCC(c3cc(Cl)c(Cl)c(Cl)c3)(C(F)(F)F)C2)ccc1-n1cncn1 |
| InChI | InChI=1S/C19H13Cl3F3N5/c20-12-4-11(5-13(21)17(12)22)18(19(23,24)25)6-15(28-7-18)10-1-2-16(14(26)3-10)30-9-27-8-29-30/h1-5,8-9H,6-7,26H2 |
| InChIKey | PONCJOGIUBLHFR-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 69.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.70 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|