C38H30N8O15 — CID 88982326
[1-[(dimethylamino)methyl]-2-hydroxy-9-oxo-7-[[2-[(2,4,5,7-tetranitrofluoren-9-ylidene)amino]oxyacetyl]oxymethyl]-11H-indolizino[1,2-b]quinolin-8-yl]methyl propanoate (PubChem CID 88982326) has the molecular formula C38H30N8O15 and a molecular weight of 838.70 g/mol. Its IUPAC name is [1-[(dimethylamino)methyl]-2-hydroxy-9-oxo-7-[[2-[(2,4,5,7-tetranitrofluoren-9-ylidene)amino]oxyacetyl]oxymethyl]-11H-indolizino[1,2-b]quinolin-8-yl]methyl propanoate.
| Compound Name | [1-[(dimethylamino)methyl]-2-hydroxy-9-oxo-7-[[2-[(2,4,5,7-tetranitrofluoren-9-ylidene)amino]oxyacetyl]oxymethyl]-11H-indolizino[1,2-b]quinolin-8-yl]methyl propanoate |
|---|---|
| PubChem CID | 88982326 |
| Molecular Formula | C38H30N8O15 |
| Molecular Weight | 838.70 g/mol |
| Exact Mass | 838.18 |
| IUPAC Name | [1-[(dimethylamino)methyl]-2-hydroxy-9-oxo-7-[[2-[(2,4,5,7-tetranitrofluoren-9-ylidene)amino]oxyacetyl]oxymethyl]-11H-indolizino[1,2-b]quinolin-8-yl]methyl propanoate |
| SMILES | CCC(=O)OCc1c(COC(=O)CON=C2c3cc([N+](=O)[O-])cc([N+](=O)[O-])c3-c3c2cc([N+](=O)[O-])cc3[N+](=O)[O-])cc2n(c1=O)Cc1cc3c(CN(C)C)c(O)ccc3nc1-2 |
| InChI | InChI=1S/C38H30N8O15/c1-4-32(48)60-16-26-19(8-30-36-18(13-42(30)38(26)50)7-22-25(14-41(2)3)31(47)6-5-27(22)39-36)15-59-33(49)17-61-40-37-23-9-20(43(51)52)11-28(45(55)56)34(23)35-24(37)10-21(44(53)54)12-29(35)46(57)58/h5-12,47H,4,13-17H2,1-3H3 |
| InChIKey | ROUKHQQKECMLAF-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 305.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 838.70 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|