C10H15N3 — CID 88982335
3-[2-[(3E,5Z)-hepta-1,3,5-trien-3-yl]hydrazinyl]propanenitrile (PubChem CID 88982335) has the molecular formula C10H15N3 and a molecular weight of 177.25 g/mol. Its IUPAC name is 3-[2-[(3E,5Z)-hepta-1,3,5-trien-3-yl]hydrazinyl]propanenitrile.
| Compound Name | 3-[2-[(3E,5Z)-hepta-1,3,5-trien-3-yl]hydrazinyl]propanenitrile |
|---|---|
| PubChem CID | 88982335 |
| Molecular Formula | C10H15N3 |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.13 |
| IUPAC Name | 3-[2-[(3E,5Z)-hepta-1,3,5-trien-3-yl]hydrazinyl]propanenitrile |
| SMILES | C=C/C(=C\C=C/C)NNCCC#N |
| InChI | InChI=1S/C10H15N3/c1-3-5-7-10(4-2)13-12-9-6-8-11/h3-5,7,12-13H,2,6,9H2,1H3/b5-3-,10-7+ |
| InChIKey | UZJXMEOGEBQXOT-ZMSZASLQSA-N |
| XLogP | 1.64 |
| TPSA | 47.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|