C26H31NO4 — CID 88982986
(10R)-15-(furan-3-yl)-12-hydroxy-13-methoxy-3-pentyl-3-azapentacyclo[8.6.1.01,4.05,10.011,16]heptadeca-11(16),12,14-trien-8-one (PubChem CID 88982986) has the molecular formula C26H31NO4 and a molecular weight of 421.54 g/mol. Its IUPAC name is (10R)-15-(furan-3-yl)-12-hydroxy-13-methoxy-3-pentyl-3-azapentacyclo[8.6.1.01,4.05,10.011,16]heptadeca-11(16),12,14-trien-8-one.
| Compound Name | (10R)-15-(furan-3-yl)-12-hydroxy-13-methoxy-3-pentyl-3-azapentacyclo[8.6.1.01,4.05,10.011,16]heptadeca-11(16),12,14-trien-8-one |
|---|---|
| PubChem CID | 88982986 |
| Molecular Formula | C26H31NO4 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.23 |
| IUPAC Name | (10R)-15-(furan-3-yl)-12-hydroxy-13-methoxy-3-pentyl-3-azapentacyclo[8.6.1.01,4.05,10.011,16]heptadeca-11(16),12,14-trien-8-one |
| SMILES | CCCCCN1CC23C[C@]4(CC(=O)CCC4C12)c1c(O)c(OC)cc(-c2ccoc2)c13 |
| InChI | InChI=1S/C26H31NO4/c1-3-4-5-9-27-15-26-14-25(12-17(28)6-7-19(25)24(26)27)22-21(26)18(16-8-10-31-13-16)11-20(30-2)23(22)29/h8,10-11,13,19,24,29H,3-7,9,12,14-15H2,1-2H3/t19?,24?,25-,26?/m0/s1 |
| InChIKey | KHPLOWRGLNLTST-PKTKUSJYSA-N |
| XLogP | 4.80 |
| TPSA | 62.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|