C19H23NO4 — CID 88982990
(1R,4S,17R)-5-prop-2-enyl-12-oxa-5-azapentacyclo[9.6.1.01,13.04,17.07,18]octadeca-7(18),8,10-triene-10,14,17-triol (PubChem CID 88982990) has the molecular formula C19H23NO4 and a molecular weight of 329.40 g/mol. Its IUPAC name is (1R,4S,17R)-5-prop-2-enyl-12-oxa-5-azapentacyclo[9.6.1.01,13.04,17.07,18]octadeca-7(18),8,10-triene-10,14,17-triol.
| Compound Name | (1R,4S,17R)-5-prop-2-enyl-12-oxa-5-azapentacyclo[9.6.1.01,13.04,17.07,18]octadeca-7(18),8,10-triene-10,14,17-triol |
|---|---|
| PubChem CID | 88982990 |
| Molecular Formula | C19H23NO4 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | (1R,4S,17R)-5-prop-2-enyl-12-oxa-5-azapentacyclo[9.6.1.01,13.04,17.07,18]octadeca-7(18),8,10-triene-10,14,17-triol |
| SMILES | C=CCN1Cc2ccc(O)c3c2[C@@]24CC[C@H]1[C@@]2(O)CCC(O)C4O3 |
| InChI | InChI=1S/C19H23NO4/c1-2-9-20-10-11-3-4-12(21)16-15(11)18-7-6-14(20)19(18,23)8-5-13(22)17(18)24-16/h2-4,13-14,17,21-23H,1,5-10H2/t13?,14-,17?,18+,19-/m0/s1 |
| InChIKey | YTRAPTZGEICANC-FGGMFUCOSA-N |
| XLogP | 1.44 |
| TPSA | 73.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|