C36H41F2N5O6Si — CID 88983462
tert-butyl 2-[(1E,3E)-3-[[1-[(3,4-difluorophenyl)methyl]pyrazol-4-yl]carbamoyl]-4-[formyl(2-trimethylsilylethoxymethyl)amino]buta-1,3-dienyl]-5-formylindole-1-carboxylate (PubChem CID 88983462) has the molecular formula C36H41F2N5O6Si and a molecular weight of 705.84 g/mol. Its IUPAC name is tert-butyl 2-[(1E,3E)-3-[[1-[(3,4-difluorophenyl)methyl]pyrazol-4-yl]carbamoyl]-4-[formyl(2-trimethylsilylethoxymethyl)amino]buta-1,3-dienyl]-5-formylindole-1-carboxylate.
| Compound Name | tert-butyl 2-[(1E,3E)-3-[[1-[(3,4-difluorophenyl)methyl]pyrazol-4-yl]carbamoyl]-4-[formyl(2-trimethylsilylethoxymethyl)amino]buta-1,3-dienyl]-5-formylindole-1-carboxylate |
|---|---|
| PubChem CID | 88983462 |
| Molecular Formula | C36H41F2N5O6Si |
| Molecular Weight | 705.84 g/mol |
| Exact Mass | 705.28 |
| IUPAC Name | tert-butyl 2-[(1E,3E)-3-[[1-[(3,4-difluorophenyl)methyl]pyrazol-4-yl]carbamoyl]-4-[formyl(2-trimethylsilylethoxymethyl)amino]buta-1,3-dienyl]-5-formylindole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1c(/C=C/C(=C\N(C=O)COCC[Si](C)(C)C)C(=O)Nc2cnn(Cc3ccc(F)c(F)c3)c2)cc2cc(C=O)ccc21 |
| InChI | InChI=1S/C36H41F2N5O6Si/c1-36(2,3)49-35(47)43-30(17-28-15-26(22-44)8-12-33(28)43)10-9-27(20-41(23-45)24-48-13-14-50(4,5)6)34(46)40-29-18-39-42(21-29)19-25-7-11-31(37)32(38)16-25/h7-12,15-18,20-23H,13-14,19,24H2,1-6H3,(H,40,46)/b10-9+,27-20+ |
| InChIKey | GZJIGBVWJWGVGK-HCLGRWHRSA-N |
| XLogP | 7.07 |
| TPSA | 124.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.84 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|