C36H44FN5O5Si — CID 88983463
tert-butyl 2-[(1E,3E)-3-[[1-[(3-fluorophenyl)methyl]pyrazole-4-carbonyl]amino]-4-[formyl(2-trimethylsilylethoxymethyl)amino]penta-1,3-dienyl]indole-1-carboxylate (PubChem CID 88983463) has the molecular formula C36H44FN5O5Si and a molecular weight of 673.86 g/mol. Its IUPAC name is tert-butyl 2-[(1E,3E)-3-[[1-[(3-fluorophenyl)methyl]pyrazole-4-carbonyl]amino]-4-[formyl(2-trimethylsilylethoxymethyl)amino]penta-1,3-dienyl]indole-1-carboxylate.
| Compound Name | tert-butyl 2-[(1E,3E)-3-[[1-[(3-fluorophenyl)methyl]pyrazole-4-carbonyl]amino]-4-[formyl(2-trimethylsilylethoxymethyl)amino]penta-1,3-dienyl]indole-1-carboxylate |
|---|---|
| PubChem CID | 88983463 |
| Molecular Formula | C36H44FN5O5Si |
| Molecular Weight | 673.86 g/mol |
| Exact Mass | 673.31 |
| IUPAC Name | tert-butyl 2-[(1E,3E)-3-[[1-[(3-fluorophenyl)methyl]pyrazole-4-carbonyl]amino]-4-[formyl(2-trimethylsilylethoxymethyl)amino]penta-1,3-dienyl]indole-1-carboxylate |
| SMILES | C/C(=C(/C=C/c1cc2ccccc2n1C(=O)OC(C)(C)C)NC(=O)c1cnn(Cc2cccc(F)c2)c1)N(C=O)COCC[Si](C)(C)C |
| InChI | InChI=1S/C36H44FN5O5Si/c1-26(40(24-43)25-46-17-18-48(5,6)7)32(39-34(44)29-21-38-41(23-29)22-27-11-10-13-30(37)19-27)16-15-31-20-28-12-8-9-14-33(28)42(31)35(45)47-36(2,3)4/h8-16,19-21,23-24H,17-18,22,25H2,1-7H3,(H,39,44)/b16-15+,32-26+ |
| InChIKey | QFARKTSRFNXHTG-CYUQWLNNSA-N |
| XLogP | 7.25 |
| TPSA | 107.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.86 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|