C37H45N5O6Si — CID 88983464
tert-butyl 5-formyl-2-[(1E,3E)-4-[formyl(2-trimethylsilylethoxymethyl)amino]-3-[[1-[(4-methylphenyl)methyl]pyrazole-4-carbonyl]amino]buta-1,3-dienyl]indole-1-carboxylate (PubChem CID 88983464) has the molecular formula C37H45N5O6Si and a molecular weight of 683.88 g/mol. Its IUPAC name is tert-butyl 5-formyl-2-[(1E,3E)-4-[formyl(2-trimethylsilylethoxymethyl)amino]-3-[[1-[(4-methylphenyl)methyl]pyrazole-4-carbonyl]amino]buta-1,3-dienyl]indole-1-carboxylate.
| Compound Name | tert-butyl 5-formyl-2-[(1E,3E)-4-[formyl(2-trimethylsilylethoxymethyl)amino]-3-[[1-[(4-methylphenyl)methyl]pyrazole-4-carbonyl]amino]buta-1,3-dienyl]indole-1-carboxylate |
|---|---|
| PubChem CID | 88983464 |
| Molecular Formula | C37H45N5O6Si |
| Molecular Weight | 683.88 g/mol |
| Exact Mass | 683.31 |
| IUPAC Name | tert-butyl 5-formyl-2-[(1E,3E)-4-[formyl(2-trimethylsilylethoxymethyl)amino]-3-[[1-[(4-methylphenyl)methyl]pyrazole-4-carbonyl]amino]buta-1,3-dienyl]indole-1-carboxylate |
| SMILES | Cc1ccc(Cn2cc(C(=O)NC(/C=C/c3cc4cc(C=O)ccc4n3C(=O)OC(C)(C)C)=C/N(C=O)COCC[Si](C)(C)C)cn2)cc1 |
| InChI | InChI=1S/C37H45N5O6Si/c1-27-8-10-28(11-9-27)21-41-22-31(20-38-41)35(45)39-32(23-40(25-44)26-47-16-17-49(5,6)7)13-14-33-19-30-18-29(24-43)12-15-34(30)42(33)36(46)48-37(2,3)4/h8-15,18-20,22-25H,16-17,21,26H2,1-7H3,(H,39,45)/b14-13+,32-23+ |
| InChIKey | GCQNDSJRZNVOJJ-FATPHJNOSA-N |
| XLogP | 6.85 |
| TPSA | 124.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.88 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|