About 7-methyl-3-propan-2-yl-2,1-benzoxazole
7-methyl-3-propan-2-yl-2,1-benzoxazole (PubChem CID 88983483) has the molecular formula C11H13NO
and a molecular weight of 175.23 g/mol. Its IUPAC name is 7-methyl-3-propan-2-yl-2,1-benzoxazole.
Molecular Properties
| Compound Name | 7-methyl-3-propan-2-yl-2,1-benzoxazole |
| PubChem CID | 88983483 |
| Molecular Formula | C11H13NO |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | 7-methyl-3-propan-2-yl-2,1-benzoxazole |
| SMILES | Cc1cccc2c(C(C)C)onc12 |
| InChI | InChI=1S/C11H13NO/c1-7(2)11-9-6-4-5-8(3)10(9)12-13-11/h4-7H,1-3H3 |
| InChIKey | VXWOVHYSWBEIFB-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-methyl-3-propan-2-yl-2,1-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-3-propan-2-yl-2,1-benzoxazole?
The IUPAC name of 7-methyl-3-propan-2-yl-2,1-benzoxazole (CID 88983483) is 7-methyl-3-propan-2-yl-2,1-benzoxazole.
What is the SMILES notation for 7-methyl-3-propan-2-yl-2,1-benzoxazole?
The canonical SMILES for 7-methyl-3-propan-2-yl-2,1-benzoxazole is Cc1cccc2c(C(C)C)onc12.
What is the InChIKey of 7-methyl-3-propan-2-yl-2,1-benzoxazole?
The InChIKey is VXWOVHYSWBEIFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO/c1-7(2)11-9-6-4-5-8(3)10(9)12-13-11/h4-7H,1-3H3.
What are the key properties of 7-methyl-3-propan-2-yl-2,1-benzoxazole?
7-methyl-3-propan-2-yl-2,1-benzoxazole has a molecular weight of 175.23 g/mol, XLogP of 3.26, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-3-propan-2-yl-2,1-benzoxazole is sourced from PubChem (CID 88983483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).