C24H33N3O5Si — CID 88983522
tert-butyl 2-[(1E,3E)-4-[formyl(2-trimethylsilylethoxymethyl)amino]-3-nitrosobuta-1,3-dienyl]indole-1-carboxylate (PubChem CID 88983522) has the molecular formula C24H33N3O5Si and a molecular weight of 471.63 g/mol. Its IUPAC name is tert-butyl 2-[(1E,3E)-4-[formyl(2-trimethylsilylethoxymethyl)amino]-3-nitrosobuta-1,3-dienyl]indole-1-carboxylate.
| Compound Name | tert-butyl 2-[(1E,3E)-4-[formyl(2-trimethylsilylethoxymethyl)amino]-3-nitrosobuta-1,3-dienyl]indole-1-carboxylate |
|---|---|
| PubChem CID | 88983522 |
| Molecular Formula | C24H33N3O5Si |
| Molecular Weight | 471.63 g/mol |
| Exact Mass | 471.22 |
| IUPAC Name | tert-butyl 2-[(1E,3E)-4-[formyl(2-trimethylsilylethoxymethyl)amino]-3-nitrosobuta-1,3-dienyl]indole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1c(/C=C/C(=C\N(C=O)COCC[Si](C)(C)C)N=O)cc2ccccc21 |
| InChI | InChI=1S/C24H33N3O5Si/c1-24(2,3)32-23(29)27-21(15-19-9-7-8-10-22(19)27)12-11-20(25-30)16-26(17-28)18-31-13-14-33(4,5)6/h7-12,15-17H,13-14,18H2,1-6H3/b12-11+,20-16+ |
| InChIKey | KSJLFKJQTHYSEP-PBBJMKGWSA-N |
| XLogP | 5.82 |
| TPSA | 90.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.63 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|