C28H35F3N4O2S — CID 88983969
1-[(2S,5R)-2,5-dimethyl-4-(4-methylphenyl)piperazin-1-yl]-2-[4-[4-nitroso-3-(trifluoromethyl)anilino]cyclohexyl]oxyethanethione (PubChem CID 88983969) has the molecular formula C28H35F3N4O2S and a molecular weight of 548.68 g/mol. Its IUPAC name is 1-[(2S,5R)-2,5-dimethyl-4-(4-methylphenyl)piperazin-1-yl]-2-[4-[4-nitroso-3-(trifluoromethyl)anilino]cyclohexyl]oxyethanethione.
| Compound Name | 1-[(2S,5R)-2,5-dimethyl-4-(4-methylphenyl)piperazin-1-yl]-2-[4-[4-nitroso-3-(trifluoromethyl)anilino]cyclohexyl]oxyethanethione |
|---|---|
| PubChem CID | 88983969 |
| Molecular Formula | C28H35F3N4O2S |
| Molecular Weight | 548.68 g/mol |
| Exact Mass | 548.24 |
| IUPAC Name | 1-[(2S,5R)-2,5-dimethyl-4-(4-methylphenyl)piperazin-1-yl]-2-[4-[4-nitroso-3-(trifluoromethyl)anilino]cyclohexyl]oxyethanethione |
| SMILES | Cc1ccc(N2C[C@H](C)N(C(=S)COC3CCC(Nc4ccc(N=O)c(C(F)(F)F)c4)CC3)C[C@H]2C)cc1 |
| InChI | InChI=1S/C28H35F3N4O2S/c1-18-4-9-23(10-5-18)34-15-20(3)35(16-19(34)2)27(38)17-37-24-11-6-21(7-12-24)32-22-8-13-26(33-36)25(14-22)28(29,30)31/h4-5,8-10,13-14,19-21,24,32H,6-7,11-12,15-17H2,1-3H3/t19-,20+,21?,24?/m1/s1 |
| InChIKey | AOXQUZJCZNOEIL-YAQHWNNOSA-N |
| XLogP | 7.08 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.68 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|