C27H35F3N4O6 — CID 88984045
2-[4-[4-(dihydroxyamino)-3-(trifluoromethyl)anilino]cyclohexyl]oxy-1-[4-(3,4-dimethoxyphenyl)piperazin-1-yl]ethanone (PubChem CID 88984045) has the molecular formula C27H35F3N4O6 and a molecular weight of 568.59 g/mol. Its IUPAC name is 2-[4-[4-(dihydroxyamino)-3-(trifluoromethyl)anilino]cyclohexyl]oxy-1-[4-(3,4-dimethoxyphenyl)piperazin-1-yl]ethanone.
| Compound Name | 2-[4-[4-(dihydroxyamino)-3-(trifluoromethyl)anilino]cyclohexyl]oxy-1-[4-(3,4-dimethoxyphenyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 88984045 |
| Molecular Formula | C27H35F3N4O6 |
| Molecular Weight | 568.59 g/mol |
| Exact Mass | 568.25 |
| IUPAC Name | 2-[4-[4-(dihydroxyamino)-3-(trifluoromethyl)anilino]cyclohexyl]oxy-1-[4-(3,4-dimethoxyphenyl)piperazin-1-yl]ethanone |
| SMILES | COc1ccc(N2CCN(C(=O)COC3CCC(Nc4ccc(N(O)O)c(C(F)(F)F)c4)CC3)CC2)cc1OC |
| InChI | InChI=1S/C27H35F3N4O6/c1-38-24-10-6-20(16-25(24)39-2)32-11-13-33(14-12-32)26(35)17-40-21-7-3-18(4-8-21)31-19-5-9-23(34(36)37)22(15-19)27(28,29)30/h5-6,9-10,15-16,18,21,31,36-37H,3-4,7-8,11-14,17H2,1-2H3 |
| InChIKey | VOGJUBOGDMWGBZ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.59 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|