C25H29F5N4O4 — CID 88984057
1-[4-(2,4-difluorophenyl)piperazin-1-yl]-2-[4-[4-(dihydroxyamino)-3-(trifluoromethyl)anilino]cyclohexyl]oxyethanone (PubChem CID 88984057) has the molecular formula C25H29F5N4O4 and a molecular weight of 544.52 g/mol. Its IUPAC name is 1-[4-(2,4-difluorophenyl)piperazin-1-yl]-2-[4-[4-(dihydroxyamino)-3-(trifluoromethyl)anilino]cyclohexyl]oxyethanone.
| Compound Name | 1-[4-(2,4-difluorophenyl)piperazin-1-yl]-2-[4-[4-(dihydroxyamino)-3-(trifluoromethyl)anilino]cyclohexyl]oxyethanone |
|---|---|
| PubChem CID | 88984057 |
| Molecular Formula | C25H29F5N4O4 |
| Molecular Weight | 544.52 g/mol |
| Exact Mass | 544.21 |
| IUPAC Name | 1-[4-(2,4-difluorophenyl)piperazin-1-yl]-2-[4-[4-(dihydroxyamino)-3-(trifluoromethyl)anilino]cyclohexyl]oxyethanone |
| SMILES | O=C(COC1CCC(Nc2ccc(N(O)O)c(C(F)(F)F)c2)CC1)N1CCN(c2ccc(F)cc2F)CC1 |
| InChI | InChI=1S/C25H29F5N4O4/c26-16-1-7-23(21(27)13-16)32-9-11-33(12-10-32)24(35)15-38-19-5-2-17(3-6-19)31-18-4-8-22(34(36)37)20(14-18)25(28,29)30/h1,4,7-8,13-14,17,19,31,36-37H,2-3,5-6,9-12,15H2 |
| InChIKey | NCISTQMKZSASDW-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.52 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|