About 5-bromo-2-methyl-2,3-dihydrothiophene
5-bromo-2-methyl-2,3-dihydrothiophene (PubChem CID 88984549) has the molecular formula C5H7BrS
and a molecular weight of 179.08 g/mol. Its IUPAC name is 5-bromo-2-methyl-2,3-dihydrothiophene.
Molecular Properties
| Compound Name | 5-bromo-2-methyl-2,3-dihydrothiophene |
| PubChem CID | 88984549 |
| Molecular Formula | C5H7BrS |
| Molecular Weight | 179.08 g/mol |
| Exact Mass | 177.95 |
| IUPAC Name | 5-bromo-2-methyl-2,3-dihydrothiophene |
| SMILES | CC1CC=C(Br)S1 |
| InChI | InChI=1S/C5H7BrS/c1-4-2-3-5(6)7-4/h3-4H,2H2,1H3 |
| InChIKey | OAIOOYDCWAKQFX-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.08 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-bromo-2-methyl-2,3-dihydrothiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2-methyl-2,3-dihydrothiophene?
The IUPAC name of 5-bromo-2-methyl-2,3-dihydrothiophene (CID 88984549) is 5-bromo-2-methyl-2,3-dihydrothiophene.
What is the SMILES notation for 5-bromo-2-methyl-2,3-dihydrothiophene?
The canonical SMILES for 5-bromo-2-methyl-2,3-dihydrothiophene is CC1CC=C(Br)S1.
What is the InChIKey of 5-bromo-2-methyl-2,3-dihydrothiophene?
The InChIKey is OAIOOYDCWAKQFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7BrS/c1-4-2-3-5(6)7-4/h3-4H,2H2,1H3.
What are the key properties of 5-bromo-2-methyl-2,3-dihydrothiophene?
5-bromo-2-methyl-2,3-dihydrothiophene has a molecular weight of 179.08 g/mol, XLogP of 2.75, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2-methyl-2,3-dihydrothiophene is sourced from PubChem (CID 88984549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).