About (Z)-2,5-diamino-6-methyl-N-propylhept-4-enamide
(Z)-2,5-diamino-6-methyl-N-propylhept-4-enamide (PubChem CID 88984632) has the molecular formula C11H23N3O
and a molecular weight of 213.32 g/mol. Its IUPAC name is (Z)-2,5-diamino-6-methyl-N-propylhept-4-enamide.
Molecular Properties
| Compound Name | (Z)-2,5-diamino-6-methyl-N-propylhept-4-enamide |
| PubChem CID | 88984632 |
| Molecular Formula | C11H23N3O |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.18 |
| IUPAC Name | (Z)-2,5-diamino-6-methyl-N-propylhept-4-enamide |
| SMILES | CCCNC(=O)C(N)C/C=C(\N)C(C)C |
| InChI | InChI=1S/C11H23N3O/c1-4-7-14-11(15)10(13)6-5-9(12)8(2)3/h5,8,10H,4,6-7,12-13H2,1-3H3,(H,14,15)/b9-5- |
| InChIKey | GBFFPAZKKXITCJ-UITAMQMPSA-N |
| XLogP | 0.73 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (Z)-2,5-diamino-6-methyl-N-propylhept-4-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2,5-diamino-6-methyl-N-propylhept-4-enamide?
The IUPAC name of (Z)-2,5-diamino-6-methyl-N-propylhept-4-enamide (CID 88984632) is (Z)-2,5-diamino-6-methyl-N-propylhept-4-enamide.
What is the SMILES notation for (Z)-2,5-diamino-6-methyl-N-propylhept-4-enamide?
The canonical SMILES for (Z)-2,5-diamino-6-methyl-N-propylhept-4-enamide is CCCNC(=O)C(N)C/C=C(\N)C(C)C.
What is the InChIKey of (Z)-2,5-diamino-6-methyl-N-propylhept-4-enamide?
The InChIKey is GBFFPAZKKXITCJ-UITAMQMPSA-N. The full InChI is InChI=1S/C11H23N3O/c1-4-7-14-11(15)10(13)6-5-9(12)8(2)3/h5,8,10H,4,6-7,12-13H2,1-3H3,(H,14,15)/b9-5-.
What are the key properties of (Z)-2,5-diamino-6-methyl-N-propylhept-4-enamide?
(Z)-2,5-diamino-6-methyl-N-propylhept-4-enamide has a molecular weight of 213.32 g/mol, XLogP of 0.73, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2,5-diamino-6-methyl-N-propylhept-4-enamide is sourced from PubChem (CID 88984632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).