C24H30O4 — CID 88984662
1-(2-buta-1,3-dien-2-yloxyethoxy)-4-[4-(2-buta-1,3-dien-2-yloxyethoxy)cyclohexa-1,3-dien-1-yl]cyclohexa-1,3-diene (PubChem CID 88984662) has the molecular formula C24H30O4 and a molecular weight of 382.50 g/mol. Its IUPAC name is 1-(2-buta-1,3-dien-2-yloxyethoxy)-4-[4-(2-buta-1,3-dien-2-yloxyethoxy)cyclohexa-1,3-dien-1-yl]cyclohexa-1,3-diene.
| Compound Name | 1-(2-buta-1,3-dien-2-yloxyethoxy)-4-[4-(2-buta-1,3-dien-2-yloxyethoxy)cyclohexa-1,3-dien-1-yl]cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 88984662 |
| Molecular Formula | C24H30O4 |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | 1-(2-buta-1,3-dien-2-yloxyethoxy)-4-[4-(2-buta-1,3-dien-2-yloxyethoxy)cyclohexa-1,3-dien-1-yl]cyclohexa-1,3-diene |
| SMILES | C=CC(=C)OCCOC1=CC=C(C2=CC=C(OCCOC(=C)C=C)CC2)CC1 |
| InChI | InChI=1S/C24H30O4/c1-5-19(3)25-15-17-27-23-11-7-21(8-12-23)22-9-13-24(14-10-22)28-18-16-26-20(4)6-2/h5-7,9,11,13H,1-4,8,10,12,14-18H2 |
| InChIKey | XCUNKZRELAPYQV-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|