C19H24O2 — CID 88984663
1-(2-buta-1,3-dien-2-yloxypropoxy)-4-cyclohexa-1,3-dien-1-ylcyclohexa-1,3-diene (PubChem CID 88984663) has the molecular formula C19H24O2 and a molecular weight of 284.40 g/mol. Its IUPAC name is 1-(2-buta-1,3-dien-2-yloxypropoxy)-4-cyclohexa-1,3-dien-1-ylcyclohexa-1,3-diene.
| Compound Name | 1-(2-buta-1,3-dien-2-yloxypropoxy)-4-cyclohexa-1,3-dien-1-ylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 88984663 |
| Molecular Formula | C19H24O2 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.18 |
| IUPAC Name | 1-(2-buta-1,3-dien-2-yloxypropoxy)-4-cyclohexa-1,3-dien-1-ylcyclohexa-1,3-diene |
| SMILES | C=CC(=C)OC(C)COC1=CC=C(C2=CC=CCC2)CC1 |
| InChI | InChI=1S/C19H24O2/c1-4-15(2)21-16(3)14-20-19-12-10-18(11-13-19)17-8-6-5-7-9-17/h4-6,8,10,12,16H,1-2,7,9,11,13-14H2,3H3 |
| InChIKey | RCOWMEPBSRUYKD-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|