C7H4F12O — CID 88984962
1,1,1,2,3,4,5,5,5-nonafluoro-2-methoxy-4-(trifluoromethyl)pentane (PubChem CID 88984962) has the molecular formula C7H4F12O and a molecular weight of 332.08 g/mol. Its IUPAC name is 1,1,1,2,3,4,5,5,5-nonafluoro-2-methoxy-4-(trifluoromethyl)pentane.
| Compound Name | 1,1,1,2,3,4,5,5,5-nonafluoro-2-methoxy-4-(trifluoromethyl)pentane |
|---|---|
| PubChem CID | 88984962 |
| Molecular Formula | C7H4F12O |
| Molecular Weight | 332.08 g/mol |
| Exact Mass | 332.01 |
| IUPAC Name | 1,1,1,2,3,4,5,5,5-nonafluoro-2-methoxy-4-(trifluoromethyl)pentane |
| SMILES | COC(F)(C(F)C(F)(C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C7H4F12O/c1-20-4(10,7(17,18)19)2(8)3(9,5(11,12)13)6(14,15)16/h2H,1H3 |
| InChIKey | KAMRUOBWXBBGTN-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.08 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |