C20H23NO4 — CID 889850
ethyl 4-[[(2S)-2-(3,4-dimethylphenoxy)propanoyl]amino]benzoate (PubChem CID 889850) has the molecular formula C20H23NO4 and a molecular weight of 341.41 g/mol. Its IUPAC name is ethyl 4-[[(2S)-2-(3,4-dimethylphenoxy)propanoyl]amino]benzoate.
| Compound Name | ethyl 4-[[(2S)-2-(3,4-dimethylphenoxy)propanoyl]amino]benzoate |
|---|---|
| PubChem CID | 889850 |
| Molecular Formula | C20H23NO4 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | ethyl 4-[[(2S)-2-(3,4-dimethylphenoxy)propanoyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)[C@H](C)Oc2ccc(C)c(C)c2)cc1 |
| InChI | InChI=1S/C20H23NO4/c1-5-24-20(23)16-7-9-17(10-8-16)21-19(22)15(4)25-18-11-6-13(2)14(3)12-18/h6-12,15H,5H2,1-4H3,(H,21,22)/t15-/m0/s1 |
| InChIKey | YKHTZXXHQCCKOA-HNNXBMFYSA-N |
| XLogP | 3.89 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |