C12H19NO — CID 88985010
10,10-dimethyl-1,3,4,6,7,10a-hexahydropyrido[1,2-a]azepin-2-one (PubChem CID 88985010) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is 10,10-dimethyl-1,3,4,6,7,10a-hexahydropyrido[1,2-a]azepin-2-one.
| Compound Name | 10,10-dimethyl-1,3,4,6,7,10a-hexahydropyrido[1,2-a]azepin-2-one |
|---|---|
| PubChem CID | 88985010 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | 10,10-dimethyl-1,3,4,6,7,10a-hexahydropyrido[1,2-a]azepin-2-one |
| SMILES | CC1(C)C=CCCN2CCC(=O)CC21 |
| InChI | InChI=1S/C12H19NO/c1-12(2)6-3-4-7-13-8-5-10(14)9-11(12)13/h3,6,11H,4-5,7-9H2,1-2H3 |
| InChIKey | SYGAOKFFOXBPMG-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|