About N-[2-[(2S)-2-formylpyrrolidin-1-yl]-2-oxoethyl]-2-methoxycyclohexa-1,5-diene-1-carboxamide
N-[2-[(2S)-2-formylpyrrolidin-1-yl]-2-oxoethyl]-2-methoxycyclohexa-1,5-diene-1-carboxamide (PubChem CID 88985046) has the molecular formula C15H20N2O4
and a molecular weight of 292.33 g/mol. Its IUPAC name is N-[2-[(2S)-2-formylpyrrolidin-1-yl]-2-oxoethyl]-2-methoxycyclohexa-1,5-diene-1-carboxamide.
Molecular Properties
| Compound Name | N-[2-[(2S)-2-formylpyrrolidin-1-yl]-2-oxoethyl]-2-methoxycyclohexa-1,5-diene-1-carboxamide |
| PubChem CID | 88985046 |
| Molecular Formula | C15H20N2O4 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | N-[2-[(2S)-2-formylpyrrolidin-1-yl]-2-oxoethyl]-2-methoxycyclohexa-1,5-diene-1-carboxamide |
| SMILES | COC1=C(C(=O)NCC(=O)N2CCC[C@H]2C=O)C=CCC1 |
| InChI | InChI=1S/C15H20N2O4/c1-21-13-7-3-2-6-12(13)15(20)16-9-14(19)17-8-4-5-11(17)10-18/h2,6,10-11H,3-5,7-9H2,1H3,(H,16,20)/t11-/m0/s1 |
| InChIKey | CSNCNAGZXWWAME-NSHDSACASA-N |
| XLogP | 0.54 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-[2-[(2S)-2-formylpyrrolidin-1-yl]-2-oxoethyl]-2-methoxycyclohexa-1,5-diene-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[(2S)-2-formylpyrrolidin-1-yl]-2-oxoethyl]-2-methoxycyclohexa-1,5-diene-1-carboxamide?
The IUPAC name of N-[2-[(2S)-2-formylpyrrolidin-1-yl]-2-oxoethyl]-2-methoxycyclohexa-1,5-diene-1-carboxamide (CID 88985046) is N-[2-[(2S)-2-formylpyrrolidin-1-yl]-2-oxoethyl]-2-methoxycyclohexa-1,5-diene-1-carboxamide.
What is the SMILES notation for N-[2-[(2S)-2-formylpyrrolidin-1-yl]-2-oxoethyl]-2-methoxycyclohexa-1,5-diene-1-carboxamide?
The canonical SMILES for N-[2-[(2S)-2-formylpyrrolidin-1-yl]-2-oxoethyl]-2-methoxycyclohexa-1,5-diene-1-carboxamide is COC1=C(C(=O)NCC(=O)N2CCC[C@H]2C=O)C=CCC1.
What is the InChIKey of N-[2-[(2S)-2-formylpyrrolidin-1-yl]-2-oxoethyl]-2-methoxycyclohexa-1,5-diene-1-carboxamide?
The InChIKey is CSNCNAGZXWWAME-NSHDSACASA-N. The full InChI is InChI=1S/C15H20N2O4/c1-21-13-7-3-2-6-12(13)15(20)16-9-14(19)17-8-4-5-11(17)10-18/h2,6,10-11H,3-5,7-9H2,1H3,(H,16,20)/t11-/m0/s1.
What are the key properties of N-[2-[(2S)-2-formylpyrrolidin-1-yl]-2-oxoethyl]-2-methoxycyclohexa-1,5-diene-1-carboxamide?
N-[2-[(2S)-2-formylpyrrolidin-1-yl]-2-oxoethyl]-2-methoxycyclohexa-1,5-diene-1-carboxamide has a molecular weight of 292.33 g/mol, XLogP of 0.54, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[(2S)-2-formylpyrrolidin-1-yl]-2-oxoethyl]-2-methoxycyclohexa-1,5-diene-1-carboxamide is sourced from PubChem (CID 88985046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).