C14H16Cl2N2O3 — CID 88985100
2,4-dichloro-N-[2-[(2S)-2-formylpyrrolidin-1-yl]-2-oxoethyl]cyclohexa-1,5-diene-1-carboxamide (PubChem CID 88985100) has the molecular formula C14H16Cl2N2O3 and a molecular weight of 331.20 g/mol. Its IUPAC name is 2,4-dichloro-N-[2-[(2S)-2-formylpyrrolidin-1-yl]-2-oxoethyl]cyclohexa-1,5-diene-1-carboxamide.
| Compound Name | 2,4-dichloro-N-[2-[(2S)-2-formylpyrrolidin-1-yl]-2-oxoethyl]cyclohexa-1,5-diene-1-carboxamide |
|---|---|
| PubChem CID | 88985100 |
| Molecular Formula | C14H16Cl2N2O3 |
| Molecular Weight | 331.20 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | 2,4-dichloro-N-[2-[(2S)-2-formylpyrrolidin-1-yl]-2-oxoethyl]cyclohexa-1,5-diene-1-carboxamide |
| SMILES | O=C[C@@H]1CCCN1C(=O)CNC(=O)C1=C(Cl)CC(Cl)C=C1 |
| InChI | InChI=1S/C14H16Cl2N2O3/c15-9-3-4-11(12(16)6-9)14(21)17-7-13(20)18-5-1-2-10(18)8-19/h3-4,8-10H,1-2,5-7H2,(H,17,21)/t9?,10-/m0/s1 |
| InChIKey | ONFBZUBSKGPKDV-AXDSSHIGSA-N |
| XLogP | 1.35 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.20 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|