C33H41F5O4 — CID 88985303
(11'R)-11'-(3-ethenylphenyl)-5,5,13'-trimethyl-17'-(1,1,2,2,2-pentafluoroethyl)spiro[1,3-dioxane-2,3'-2,4,6,7,8,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene]-5',17'-diol (PubChem CID 88985303) has the molecular formula C33H41F5O4 and a molecular weight of 596.68 g/mol. Its IUPAC name is (11'R)-11'-(3-ethenylphenyl)-5,5,13'-trimethyl-17'-(1,1,2,2,2-pentafluoroethyl)spiro[1,3-dioxane-2,3'-2,4,6,7,8,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene]-5',17'-diol.
| Compound Name | (11'R)-11'-(3-ethenylphenyl)-5,5,13'-trimethyl-17'-(1,1,2,2,2-pentafluoroethyl)spiro[1,3-dioxane-2,3'-2,4,6,7,8,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene]-5',17'-diol |
|---|---|
| PubChem CID | 88985303 |
| Molecular Formula | C33H41F5O4 |
| Molecular Weight | 596.68 g/mol |
| Exact Mass | 596.29 |
| IUPAC Name | (11'R)-11'-(3-ethenylphenyl)-5,5,13'-trimethyl-17'-(1,1,2,2,2-pentafluoroethyl)spiro[1,3-dioxane-2,3'-2,4,6,7,8,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene]-5',17'-diol |
| SMILES | C=Cc1cccc([C@H]2CC3(C)C(CCC3(O)C(F)(F)C(F)(F)F)C3CCC4(O)CC5(CCC4=C32)OCC(C)(C)CO5)c1 |
| InChI | InChI=1S/C33H41F5O4/c1-5-20-7-6-8-21(15-20)23-16-28(4)24(11-14-31(28,40)32(34,35)33(36,37)38)22-9-12-29(39)17-30(13-10-25(29)26(22)23)41-18-27(2,3)19-42-30/h5-8,15,22-24,39-40H,1,9-14,16-19H2,2-4H3/t22?,23-,24?,28?,29?,31?/m1/s1 |
| InChIKey | IAPYPEXNAQSJSA-PSFVRTFCSA-N |
| XLogP | 7.55 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.68 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|