About CID 88985324
CID 88985324 (PubChem CID 88985324) has the molecular formula C25H21BN4O
and a molecular weight of 404.28 g/mol.
Molecular Properties
| Compound Name | CID 88985324 |
| PubChem CID | 88985324 |
| Molecular Formula | C25H21BN4O |
| Molecular Weight | 404.28 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | — |
| SMILES | [B]c1ccc2c3nc4ccc(N(CC)CC)cc4oc-3c/c(=N\c3ccncc3)c2c1 |
| InChI | InChI=1S/C25H21BN4O/c1-3-30(4-2)18-6-8-21-23(14-18)31-24-15-22(28-17-9-11-27-12-10-17)20-13-16(26)5-7-19(20)25(24)29-21/h5-15H,3-4H2,1-2H3/b28-22+ |
| InChIKey | DODHAEOAVXAMJT-XAYXJRQQSA-N |
| XLogP | 4.35 |
| TPSA | 54.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.28 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze CID 88985324 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 88985324?
The IUPAC name of CID 88985324 (CID 88985324) is not available.
What is the SMILES notation for CID 88985324?
The canonical SMILES for CID 88985324 is [B]c1ccc2c3nc4ccc(N(CC)CC)cc4oc-3c/c(=N\c3ccncc3)c2c1.
What is the InChIKey of CID 88985324?
The InChIKey is DODHAEOAVXAMJT-XAYXJRQQSA-N. The full InChI is InChI=1S/C25H21BN4O/c1-3-30(4-2)18-6-8-21-23(14-18)31-24-15-22(28-17-9-11-27-12-10-17)20-13-16(26)5-7-19(20)25(24)29-21/h5-15H,3-4H2,1-2H3/b28-22+.
What are the key properties of CID 88985324?
CID 88985324 has a molecular weight of 404.28 g/mol, XLogP of 4.35, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 88985324 is sourced from PubChem (CID 88985324), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).