C33H35F5O2S — CID 88985375
(5R,7S)-8-ethyl-7-methyl-5-[4-(4-methylsulfanylphenyl)phenyl]-7-[(1S)-2,2,3,3,3-pentafluoro-1-hydroxypropyl]-3,4,5,6,8,8a,9,10-octahydrophenanthren-2-one (PubChem CID 88985375) has the molecular formula C33H35F5O2S and a molecular weight of 590.70 g/mol. Its IUPAC name is (5R,7S)-8-ethyl-7-methyl-5-[4-(4-methylsulfanylphenyl)phenyl]-7-[(1S)-2,2,3,3,3-pentafluoro-1-hydroxypropyl]-3,4,5,6,8,8a,9,10-octahydrophenanthren-2-one.
| Compound Name | (5R,7S)-8-ethyl-7-methyl-5-[4-(4-methylsulfanylphenyl)phenyl]-7-[(1S)-2,2,3,3,3-pentafluoro-1-hydroxypropyl]-3,4,5,6,8,8a,9,10-octahydrophenanthren-2-one |
|---|---|
| PubChem CID | 88985375 |
| Molecular Formula | C33H35F5O2S |
| Molecular Weight | 590.70 g/mol |
| Exact Mass | 590.23 |
| IUPAC Name | (5R,7S)-8-ethyl-7-methyl-5-[4-(4-methylsulfanylphenyl)phenyl]-7-[(1S)-2,2,3,3,3-pentafluoro-1-hydroxypropyl]-3,4,5,6,8,8a,9,10-octahydrophenanthren-2-one |
| SMILES | CCC1C2CCC3=CC(=O)CCC3=C2[C@@H](c2ccc(-c3ccc(SC)cc3)cc2)C[C@]1(C)[C@H](O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C33H35F5O2S/c1-4-28-26-15-11-22-17-23(39)12-16-25(22)29(26)27(18-31(28,2)30(40)32(34,35)33(36,37)38)21-7-5-19(6-8-21)20-9-13-24(41-3)14-10-20/h5-10,13-14,17,26-28,30,40H,4,11-12,15-16,18H2,1-3H3/t26?,27-,28?,30+,31+/m1/s1 |
| InChIKey | TZFGKBRYUATPEJ-MUDKOERHSA-N |
| XLogP | 9.15 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.70 |
| LogP ≤ 5 | 9.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|