About (Z)-[(2Z)-2,4-dimethylpenta-2,4-dienylidene]hydrazine
(Z)-[(2Z)-2,4-dimethylpenta-2,4-dienylidene]hydrazine (PubChem CID 88985419) has the molecular formula C7H12N2
and a molecular weight of 124.19 g/mol. Its IUPAC name is (Z)-[(2Z)-2,4-dimethylpenta-2,4-dienylidene]hydrazine.
Molecular Properties
| Compound Name | (Z)-[(2Z)-2,4-dimethylpenta-2,4-dienylidene]hydrazine |
| PubChem CID | 88985419 |
| Molecular Formula | C7H12N2 |
| Molecular Weight | 124.19 g/mol |
| Exact Mass | 124.10 |
| IUPAC Name | (Z)-[(2Z)-2,4-dimethylpenta-2,4-dienylidene]hydrazine |
| SMILES | C=C(C)/C=C(C)\C=N/N |
| InChI | InChI=1S/C7H12N2/c1-6(2)4-7(3)5-9-8/h4-5H,1,8H2,2-3H3/b7-4-,9-5- |
| InChIKey | AXLJEZGAGCCGNP-HZLSWQDRSA-N |
| XLogP | 1.45 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.19 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-[(2Z)-2,4-dimethylpenta-2,4-dienylidene]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-[(2Z)-2,4-dimethylpenta-2,4-dienylidene]hydrazine?
The IUPAC name of (Z)-[(2Z)-2,4-dimethylpenta-2,4-dienylidene]hydrazine (CID 88985419) is (Z)-[(2Z)-2,4-dimethylpenta-2,4-dienylidene]hydrazine.
What is the SMILES notation for (Z)-[(2Z)-2,4-dimethylpenta-2,4-dienylidene]hydrazine?
The canonical SMILES for (Z)-[(2Z)-2,4-dimethylpenta-2,4-dienylidene]hydrazine is C=C(C)/C=C(C)\C=N/N.
What is the InChIKey of (Z)-[(2Z)-2,4-dimethylpenta-2,4-dienylidene]hydrazine?
The InChIKey is AXLJEZGAGCCGNP-HZLSWQDRSA-N. The full InChI is InChI=1S/C7H12N2/c1-6(2)4-7(3)5-9-8/h4-5H,1,8H2,2-3H3/b7-4-,9-5-.
What are the key properties of (Z)-[(2Z)-2,4-dimethylpenta-2,4-dienylidene]hydrazine?
(Z)-[(2Z)-2,4-dimethylpenta-2,4-dienylidene]hydrazine has a molecular weight of 124.19 g/mol, XLogP of 1.45, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-[(2Z)-2,4-dimethylpenta-2,4-dienylidene]hydrazine is sourced from PubChem (CID 88985419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).