About 3-cyclohexa-1,5-dien-1-yl-1,2-dihydropyrazin-6-amine
3-cyclohexa-1,5-dien-1-yl-1,2-dihydropyrazin-6-amine (PubChem CID 88985554) has the molecular formula C10H13N3
and a molecular weight of 175.24 g/mol. Its IUPAC name is 3-cyclohexa-1,5-dien-1-yl-1,2-dihydropyrazin-6-amine.
Molecular Properties
| Compound Name | 3-cyclohexa-1,5-dien-1-yl-1,2-dihydropyrazin-6-amine |
| PubChem CID | 88985554 |
| Molecular Formula | C10H13N3 |
| Molecular Weight | 175.24 g/mol |
| Exact Mass | 175.11 |
| IUPAC Name | 3-cyclohexa-1,5-dien-1-yl-1,2-dihydropyrazin-6-amine |
| SMILES | NC1=CN=C(C2=CCCC=C2)CN1 |
| InChI | InChI=1S/C10H13N3/c11-10-7-12-9(6-13-10)8-4-2-1-3-5-8/h2,4-5,7,13H,1,3,6,11H2 |
| InChIKey | YILKHWNMOVIMFR-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.24 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-cyclohexa-1,5-dien-1-yl-1,2-dihydropyrazin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclohexa-1,5-dien-1-yl-1,2-dihydropyrazin-6-amine?
The IUPAC name of 3-cyclohexa-1,5-dien-1-yl-1,2-dihydropyrazin-6-amine (CID 88985554) is 3-cyclohexa-1,5-dien-1-yl-1,2-dihydropyrazin-6-amine.
What is the SMILES notation for 3-cyclohexa-1,5-dien-1-yl-1,2-dihydropyrazin-6-amine?
The canonical SMILES for 3-cyclohexa-1,5-dien-1-yl-1,2-dihydropyrazin-6-amine is NC1=CN=C(C2=CCCC=C2)CN1.
What is the InChIKey of 3-cyclohexa-1,5-dien-1-yl-1,2-dihydropyrazin-6-amine?
The InChIKey is YILKHWNMOVIMFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3/c11-10-7-12-9(6-13-10)8-4-2-1-3-5-8/h2,4-5,7,13H,1,3,6,11H2.
What are the key properties of 3-cyclohexa-1,5-dien-1-yl-1,2-dihydropyrazin-6-amine?
3-cyclohexa-1,5-dien-1-yl-1,2-dihydropyrazin-6-amine has a molecular weight of 175.24 g/mol, XLogP of 1.06, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclohexa-1,5-dien-1-yl-1,2-dihydropyrazin-6-amine is sourced from PubChem (CID 88985554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).