C35H37F5O4S — CID 88985643
(5R)-8-ethyl-7-methyl-5-[4-[(E)-2-(4-methylsulfonylphenyl)ethenyl]phenyl]-7-(2,2,3,3,3-pentafluoro-1-hydroxypropyl)-3,4,5,6,8,8a,9,10-octahydrophenanthren-2-one (PubChem CID 88985643) has the molecular formula C35H37F5O4S and a molecular weight of 648.73 g/mol. Its IUPAC name is (5R)-8-ethyl-7-methyl-5-[4-[(E)-2-(4-methylsulfonylphenyl)ethenyl]phenyl]-7-(2,2,3,3,3-pentafluoro-1-hydroxypropyl)-3,4,5,6,8,8a,9,10-octahydrophenanthren-2-one.
| Compound Name | (5R)-8-ethyl-7-methyl-5-[4-[(E)-2-(4-methylsulfonylphenyl)ethenyl]phenyl]-7-(2,2,3,3,3-pentafluoro-1-hydroxypropyl)-3,4,5,6,8,8a,9,10-octahydrophenanthren-2-one |
|---|---|
| PubChem CID | 88985643 |
| Molecular Formula | C35H37F5O4S |
| Molecular Weight | 648.73 g/mol |
| Exact Mass | 648.23 |
| IUPAC Name | (5R)-8-ethyl-7-methyl-5-[4-[(E)-2-(4-methylsulfonylphenyl)ethenyl]phenyl]-7-(2,2,3,3,3-pentafluoro-1-hydroxypropyl)-3,4,5,6,8,8a,9,10-octahydrophenanthren-2-one |
| SMILES | CCC1C2CCC3=CC(=O)CCC3=C2[C@@H](c2ccc(/C=C/c3ccc(S(C)(=O)=O)cc3)cc2)CC1(C)C(O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C35H37F5O4S/c1-4-30-28-17-13-24-19-25(41)14-18-27(24)31(28)29(20-33(30,2)32(42)34(36,37)35(38,39)40)23-11-7-21(8-12-23)5-6-22-9-15-26(16-10-22)45(3,43)44/h5-12,15-16,19,28-30,32,42H,4,13-14,17-18,20H2,1-3H3/b6-5+/t28?,29-,30?,32?,33?/m1/s1 |
| InChIKey | SQXHJRLYHYEDTQ-MODKGOPYSA-N |
| XLogP | 8.33 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.73 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|