C34H39FN2O2 — CID 88985735
(11R,13S)-11-[4-[[1-(4-fluoroanilino)ethenylamino]methyl]phenyl]-17-hydroxy-13,17-dimethyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 88985735) has the molecular formula C34H39FN2O2 and a molecular weight of 526.70 g/mol. Its IUPAC name is (11R,13S)-11-[4-[[1-(4-fluoroanilino)ethenylamino]methyl]phenyl]-17-hydroxy-13,17-dimethyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (11R,13S)-11-[4-[[1-(4-fluoroanilino)ethenylamino]methyl]phenyl]-17-hydroxy-13,17-dimethyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 88985735 |
| Molecular Formula | C34H39FN2O2 |
| Molecular Weight | 526.70 g/mol |
| Exact Mass | 526.30 |
| IUPAC Name | (11R,13S)-11-[4-[[1-(4-fluoroanilino)ethenylamino]methyl]phenyl]-17-hydroxy-13,17-dimethyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | C=C(NCc1ccc([C@H]2C[C@@]3(C)C(CCC3(C)O)C3CCC4=CC(=O)CCC4=C32)cc1)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C34H39FN2O2/c1-21(37-26-11-9-25(35)10-12-26)36-20-22-4-6-23(7-5-22)30-19-33(2)31(16-17-34(33,3)39)29-14-8-24-18-27(38)13-15-28(24)32(29)30/h4-7,9-12,18,29-31,36-37,39H,1,8,13-17,19-20H2,2-3H3/t29?,30-,31?,33+,34?/m1/s1 |
| InChIKey | MLCZBJRGZVQQQN-SELQERBPSA-N |
| XLogP | 7.15 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.70 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |