C60H38N2O6 — CID 88985935
[8-[9-[3-(8-carbazol-9-yl-2-prop-2-enoyloxydibenzofuran-4-yl)phenyl]carbazol-3-yl]-6,7-dihydrodibenzofuran-2-yl] prop-2-enoate (PubChem CID 88985935) has the molecular formula C60H38N2O6 and a molecular weight of 882.97 g/mol. Its IUPAC name is [8-[9-[3-(8-carbazol-9-yl-2-prop-2-enoyloxydibenzofuran-4-yl)phenyl]carbazol-3-yl]-6,7-dihydrodibenzofuran-2-yl] prop-2-enoate.
| Compound Name | [8-[9-[3-(8-carbazol-9-yl-2-prop-2-enoyloxydibenzofuran-4-yl)phenyl]carbazol-3-yl]-6,7-dihydrodibenzofuran-2-yl] prop-2-enoate |
|---|---|
| PubChem CID | 88985935 |
| Molecular Formula | C60H38N2O6 |
| Molecular Weight | 882.97 g/mol |
| Exact Mass | 882.27 |
| IUPAC Name | [8-[9-[3-(8-carbazol-9-yl-2-prop-2-enoyloxydibenzofuran-4-yl)phenyl]carbazol-3-yl]-6,7-dihydrodibenzofuran-2-yl] prop-2-enoate |
| SMILES | C=CC(=O)Oc1ccc2oc3c(c2c1)C=C(c1ccc2c(c1)c1ccccc1n2-c1cccc(-c2cc(OC(=O)C=C)cc4c2oc2ccc(-n5c6ccccc6c6ccccc65)cc24)c1)CC3 |
| InChI | InChI=1S/C60H38N2O6/c1-3-58(63)65-40-23-27-56-49(32-40)47-30-36(21-25-55(47)67-56)35-20-24-54-46(29-35)44-16-7-10-19-53(44)61(54)38-13-11-12-37(28-38)45-33-41(66-59(64)4-2)34-50-48-31-39(22-26-57(48)68-60(45)50)62-51-17-8-5-14-42(51)43-15-6-9-18-52(43)62/h3-20,22-24,26-34H,1-2,21,25H2 |
| InChIKey | NNVSMBGRNUKLLO-UHFFFAOYSA-N |
| XLogP | 14.86 |
| TPSA | 88.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 882.97 |
| LogP ≤ 5 | 14.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|