C36H68O4Si2 — CID 88986042
[(1S,2R,3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-hex-5-enyl-3-[(E,3R,5S)-3-[2-[hydroxy(dimethyl)silyl]-2-methylpropyl]-5-methylnon-1-enyl]cyclopentyl] prop-2-enoate (PubChem CID 88986042) has the molecular formula C36H68O4Si2 and a molecular weight of 621.11 g/mol. Its IUPAC name is [(1S,2R,3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-hex-5-enyl-3-[(E,3R,5S)-3-[2-[hydroxy(dimethyl)silyl]-2-methylpropyl]-5-methylnon-1-enyl]cyclopentyl] prop-2-enoate.
| Compound Name | [(1S,2R,3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-hex-5-enyl-3-[(E,3R,5S)-3-[2-[hydroxy(dimethyl)silyl]-2-methylpropyl]-5-methylnon-1-enyl]cyclopentyl] prop-2-enoate |
|---|---|
| PubChem CID | 88986042 |
| Molecular Formula | C36H68O4Si2 |
| Molecular Weight | 621.11 g/mol |
| Exact Mass | 620.47 |
| IUPAC Name | [(1S,2R,3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-hex-5-enyl-3-[(E,3R,5S)-3-[2-[hydroxy(dimethyl)silyl]-2-methylpropyl]-5-methylnon-1-enyl]cyclopentyl] prop-2-enoate |
| SMILES | C=CCCCC[C@@H]1[C@@H](/C=C/[C@H](C[C@@H](C)CCCC)CC(C)(C)[Si](C)(C)O)[C@H](O[Si](C)(C)C(C)(C)C)C[C@@H]1OC(=O)C=C |
| InChI | InChI=1S/C36H68O4Si2/c1-14-17-19-20-22-30-31(33(26-32(30)39-34(37)16-3)40-42(12,13)35(5,6)7)24-23-29(25-28(4)21-18-15-2)27-36(8,9)41(10,11)38/h14,16,23-24,28-33,38H,1,3,15,17-22,25-27H2,2,4-13H3/b24-23+/t28-,29+,30+,31+,32-,33+/m0/s1 |
| InChIKey | HRJPPDIWFIBEJI-ZCRIRDNUSA-N |
| XLogP | 10.61 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.11 |
| LogP ≤ 5 | 10.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|