C9H14N2 — CID 88986515
5-[(1Z)-buta-1,3-dienyl]-1,2,3,6-tetrahydropyridin-4-amine (PubChem CID 88986515) has the molecular formula C9H14N2 and a molecular weight of 150.22 g/mol. Its IUPAC name is 5-[(1Z)-buta-1,3-dienyl]-1,2,3,6-tetrahydropyridin-4-amine.
| Compound Name | 5-[(1Z)-buta-1,3-dienyl]-1,2,3,6-tetrahydropyridin-4-amine |
|---|---|
| PubChem CID | 88986515 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | 5-[(1Z)-buta-1,3-dienyl]-1,2,3,6-tetrahydropyridin-4-amine |
| SMILES | C=C/C=C\C1=C(N)CCNC1 |
| InChI | InChI=1S/C9H14N2/c1-2-3-4-8-7-11-6-5-9(8)10/h2-4,11H,1,5-7,10H2/b4-3- |
| InChIKey | NGEFHSYXGQBFNQ-ARJAWSKDSA-N |
| XLogP | 0.93 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|