C22H25N3O5S — CID 88986829
3-[5-[[4-[2-[methyl(pyridin-2-yl)amino]ethoxy]phenyl]methyl]-2,4-dioxo-1,3-thiazolidin-3-yl]butanoic acid (PubChem CID 88986829) has the molecular formula C22H25N3O5S and a molecular weight of 443.53 g/mol. Its IUPAC name is 3-[5-[[4-[2-[methyl(pyridin-2-yl)amino]ethoxy]phenyl]methyl]-2,4-dioxo-1,3-thiazolidin-3-yl]butanoic acid.
| Compound Name | 3-[5-[[4-[2-[methyl(pyridin-2-yl)amino]ethoxy]phenyl]methyl]-2,4-dioxo-1,3-thiazolidin-3-yl]butanoic acid |
|---|---|
| PubChem CID | 88986829 |
| Molecular Formula | C22H25N3O5S |
| Molecular Weight | 443.53 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | 3-[5-[[4-[2-[methyl(pyridin-2-yl)amino]ethoxy]phenyl]methyl]-2,4-dioxo-1,3-thiazolidin-3-yl]butanoic acid |
| SMILES | CC(CC(=O)O)N1C(=O)SC(Cc2ccc(OCCN(C)c3ccccn3)cc2)C1=O |
| InChI | InChI=1S/C22H25N3O5S/c1-15(13-20(26)27)25-21(28)18(31-22(25)29)14-16-6-8-17(9-7-16)30-12-11-24(2)19-5-3-4-10-23-19/h3-10,15,18H,11-14H2,1-2H3,(H,26,27) |
| InChIKey | FDDHVGHFCVOBEW-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 100.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.53 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|