About (E)-N,2-dimethyl-3-[1-[3-(trifluoromethyl)phenyl]but-3-enylideneamino]prop-2-en-1-amine
(E)-N,2-dimethyl-3-[1-[3-(trifluoromethyl)phenyl]but-3-enylideneamino]prop-2-en-1-amine (PubChem CID 88986873) has the molecular formula C16H19F3N2
and a molecular weight of 296.34 g/mol. Its IUPAC name is (E)-N,2-dimethyl-3-[1-[3-(trifluoromethyl)phenyl]but-3-enylideneamino]prop-2-en-1-amine.
Molecular Properties
| Compound Name | (E)-N,2-dimethyl-3-[1-[3-(trifluoromethyl)phenyl]but-3-enylideneamino]prop-2-en-1-amine |
| PubChem CID | 88986873 |
| Molecular Formula | C16H19F3N2 |
| Molecular Weight | 296.34 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | (E)-N,2-dimethyl-3-[1-[3-(trifluoromethyl)phenyl]but-3-enylideneamino]prop-2-en-1-amine |
| SMILES | C=CC/C(=N\C=C(/C)CNC)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H19F3N2/c1-4-6-15(21-11-12(2)10-20-3)13-7-5-8-14(9-13)16(17,18)19/h4-5,7-9,11,20H,1,6,10H2,2-3H3/b12-11+,21-15+ |
| InChIKey | AQWULZJWJPEDIF-ZIKJKZHMSA-N |
| XLogP | 4.19 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.34 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-N,2-dimethyl-3-[1-[3-(trifluoromethyl)phenyl]but-3-enylideneamino]prop-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N,2-dimethyl-3-[1-[3-(trifluoromethyl)phenyl]but-3-enylideneamino]prop-2-en-1-amine?
The IUPAC name of (E)-N,2-dimethyl-3-[1-[3-(trifluoromethyl)phenyl]but-3-enylideneamino]prop-2-en-1-amine (CID 88986873) is (E)-N,2-dimethyl-3-[1-[3-(trifluoromethyl)phenyl]but-3-enylideneamino]prop-2-en-1-amine.
What is the SMILES notation for (E)-N,2-dimethyl-3-[1-[3-(trifluoromethyl)phenyl]but-3-enylideneamino]prop-2-en-1-amine?
The canonical SMILES for (E)-N,2-dimethyl-3-[1-[3-(trifluoromethyl)phenyl]but-3-enylideneamino]prop-2-en-1-amine is C=CC/C(=N\C=C(/C)CNC)c1cccc(C(F)(F)F)c1.
What is the InChIKey of (E)-N,2-dimethyl-3-[1-[3-(trifluoromethyl)phenyl]but-3-enylideneamino]prop-2-en-1-amine?
The InChIKey is AQWULZJWJPEDIF-ZIKJKZHMSA-N. The full InChI is InChI=1S/C16H19F3N2/c1-4-6-15(21-11-12(2)10-20-3)13-7-5-8-14(9-13)16(17,18)19/h4-5,7-9,11,20H,1,6,10H2,2-3H3/b12-11+,21-15+.
What are the key properties of (E)-N,2-dimethyl-3-[1-[3-(trifluoromethyl)phenyl]but-3-enylideneamino]prop-2-en-1-amine?
(E)-N,2-dimethyl-3-[1-[3-(trifluoromethyl)phenyl]but-3-enylideneamino]prop-2-en-1-amine has a molecular weight of 296.34 g/mol, XLogP of 4.19, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N,2-dimethyl-3-[1-[3-(trifluoromethyl)phenyl]but-3-enylideneamino]prop-2-en-1-amine is sourced from PubChem (CID 88986873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).