C34H51N — CID 88987024
(1Z,5Z,7E)-1-(cyclohexen-1-yl)-N-[(E)-dec-4-en-3-yl]-7-(4-ethenylcyclohex-2-en-1-yl)-4-methylidenenona-1,5,7-trien-1-amine (PubChem CID 88987024) has the molecular formula C34H51N and a molecular weight of 473.79 g/mol. Its IUPAC name is (1Z,5Z,7E)-1-(cyclohexen-1-yl)-N-[(E)-dec-4-en-3-yl]-7-(4-ethenylcyclohex-2-en-1-yl)-4-methylidenenona-1,5,7-trien-1-amine.
| Compound Name | (1Z,5Z,7E)-1-(cyclohexen-1-yl)-N-[(E)-dec-4-en-3-yl]-7-(4-ethenylcyclohex-2-en-1-yl)-4-methylidenenona-1,5,7-trien-1-amine |
|---|---|
| PubChem CID | 88987024 |
| Molecular Formula | C34H51N |
| Molecular Weight | 473.79 g/mol |
| Exact Mass | 473.40 |
| IUPAC Name | (1Z,5Z,7E)-1-(cyclohexen-1-yl)-N-[(E)-dec-4-en-3-yl]-7-(4-ethenylcyclohex-2-en-1-yl)-4-methylidenenona-1,5,7-trien-1-amine |
| SMILES | C=CC1C=CC(C(/C=C\C(=C)C/C=C(\NC(/C=C/CCCCC)CC)C2=CCCCC2)=C/C)CC1 |
| InChI | InChI=1S/C34H51N/c1-6-10-11-12-16-19-33(9-4)35-34(32-17-14-13-15-18-32)27-21-28(5)20-24-30(8-3)31-25-22-29(7-2)23-26-31/h7-8,16-17,19-20,22,24-25,27,29,31,33,35H,2,5-6,9-15,18,21,23,26H2,1,3-4H3/b19-16+,24-20-,30-8+,34-27- |
| InChIKey | WYNCIIHDJWUONG-WVKXKCSLSA-N |
| XLogP | 10.09 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.79 |
| LogP ≤ 5 | 10.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|