C23H16N2O5 — CID 88987144
[3-[(4-oxo-3H-phthalazin-1-yl)methyl]phenyl] 1,3-benzodioxole-5-carboxylate (PubChem CID 88987144) has the molecular formula C23H16N2O5 and a molecular weight of 400.39 g/mol. Its IUPAC name is [3-[(4-oxo-3H-phthalazin-1-yl)methyl]phenyl] 1,3-benzodioxole-5-carboxylate.
| Compound Name | [3-[(4-oxo-3H-phthalazin-1-yl)methyl]phenyl] 1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 88987144 |
| Molecular Formula | C23H16N2O5 |
| Molecular Weight | 400.39 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | [3-[(4-oxo-3H-phthalazin-1-yl)methyl]phenyl] 1,3-benzodioxole-5-carboxylate |
| SMILES | O=C(Oc1cccc(Cc2n[nH]c(=O)c3ccccc23)c1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C23H16N2O5/c26-22-18-7-2-1-6-17(18)19(24-25-22)11-14-4-3-5-16(10-14)30-23(27)15-8-9-20-21(12-15)29-13-28-20/h1-10,12H,11,13H2,(H,25,26) |
| InChIKey | CMHCYAQDDTWPCD-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 90.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.39 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|