C14H21NO3 — CID 88987189
2-[(3Z)-5-hydroxypenta-1,3-dien-2-yl]-3,4,4a,5,8,8a-hexahydro-1H-isoquinoline-1,6-diol (PubChem CID 88987189) has the molecular formula C14H21NO3 and a molecular weight of 251.33 g/mol. Its IUPAC name is 2-[(3Z)-5-hydroxypenta-1,3-dien-2-yl]-3,4,4a,5,8,8a-hexahydro-1H-isoquinoline-1,6-diol.
| Compound Name | 2-[(3Z)-5-hydroxypenta-1,3-dien-2-yl]-3,4,4a,5,8,8a-hexahydro-1H-isoquinoline-1,6-diol |
|---|---|
| PubChem CID | 88987189 |
| Molecular Formula | C14H21NO3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | 2-[(3Z)-5-hydroxypenta-1,3-dien-2-yl]-3,4,4a,5,8,8a-hexahydro-1H-isoquinoline-1,6-diol |
| SMILES | C=C(/C=C\CO)N1CCC2CC(O)=CCC2C1O |
| InChI | InChI=1S/C14H21NO3/c1-10(3-2-8-16)15-7-6-11-9-12(17)4-5-13(11)14(15)18/h2-4,11,13-14,16-18H,1,5-9H2/b3-2- |
| InChIKey | RBYNWLKEJIFBIO-IHWYPQMZSA-N |
| XLogP | 1.54 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|