About 1-azatricyclo[3.3.1.03,7]nonan-5-ol
1-azatricyclo[3.3.1.03,7]nonan-5-ol (PubChem CID 88987466) has the molecular formula C8H13NO
and a molecular weight of 139.20 g/mol. Its IUPAC name is 1-azatricyclo[3.3.1.03,7]nonan-5-ol.
Molecular Properties
| Compound Name | 1-azatricyclo[3.3.1.03,7]nonan-5-ol |
| PubChem CID | 88987466 |
| Molecular Formula | C8H13NO |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.10 |
| IUPAC Name | 1-azatricyclo[3.3.1.03,7]nonan-5-ol |
| SMILES | OC12CC3CN(CC3C1)C2 |
| InChI | InChI=1S/C8H13NO/c10-8-1-6-3-9(5-8)4-7(6)2-8/h6-7,10H,1-5H2 |
| InChIKey | HKWZHRMZNRUNFR-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-azatricyclo[3.3.1.03,7]nonan-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-azatricyclo[3.3.1.03,7]nonan-5-ol?
The IUPAC name of 1-azatricyclo[3.3.1.03,7]nonan-5-ol (CID 88987466) is 1-azatricyclo[3.3.1.03,7]nonan-5-ol.
What is the SMILES notation for 1-azatricyclo[3.3.1.03,7]nonan-5-ol?
The canonical SMILES for 1-azatricyclo[3.3.1.03,7]nonan-5-ol is OC12CC3CN(CC3C1)C2.
What is the InChIKey of 1-azatricyclo[3.3.1.03,7]nonan-5-ol?
The InChIKey is HKWZHRMZNRUNFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO/c10-8-1-6-3-9(5-8)4-7(6)2-8/h6-7,10H,1-5H2.
What are the key properties of 1-azatricyclo[3.3.1.03,7]nonan-5-ol?
1-azatricyclo[3.3.1.03,7]nonan-5-ol has a molecular weight of 139.20 g/mol, XLogP of 0.07, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-azatricyclo[3.3.1.03,7]nonan-5-ol is sourced from PubChem (CID 88987466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).