About 2-[(E)-2-amino-2-chloroethenyl]imino-N,N-dimethylbut-3-enamide
2-[(E)-2-amino-2-chloroethenyl]imino-N,N-dimethylbut-3-enamide (PubChem CID 88987512) has the molecular formula C8H12ClN3O
and a molecular weight of 201.66 g/mol. Its IUPAC name is 2-[(E)-2-amino-2-chloroethenyl]imino-N,N-dimethylbut-3-enamide.
Molecular Properties
| Compound Name | 2-[(E)-2-amino-2-chloroethenyl]imino-N,N-dimethylbut-3-enamide |
| PubChem CID | 88987512 |
| Molecular Formula | C8H12ClN3O |
| Molecular Weight | 201.66 g/mol |
| Exact Mass | 201.07 |
| IUPAC Name | 2-[(E)-2-amino-2-chloroethenyl]imino-N,N-dimethylbut-3-enamide |
| SMILES | C=C/C(=N\C=C(/N)Cl)C(=O)N(C)C |
| InChI | InChI=1S/C8H12ClN3O/c1-4-6(8(13)12(2)3)11-5-7(9)10/h4-5H,1,10H2,2-3H3/b7-5-,11-6+ |
| InChIKey | MHFQQCRFNQAFMD-LAVHUSFLSA-N |
| XLogP | 0.70 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.66 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 2-[(E)-2-amino-2-chloroethenyl]imino-N,N-dimethylbut-3-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(E)-2-amino-2-chloroethenyl]imino-N,N-dimethylbut-3-enamide?
The IUPAC name of 2-[(E)-2-amino-2-chloroethenyl]imino-N,N-dimethylbut-3-enamide (CID 88987512) is 2-[(E)-2-amino-2-chloroethenyl]imino-N,N-dimethylbut-3-enamide.
What is the SMILES notation for 2-[(E)-2-amino-2-chloroethenyl]imino-N,N-dimethylbut-3-enamide?
The canonical SMILES for 2-[(E)-2-amino-2-chloroethenyl]imino-N,N-dimethylbut-3-enamide is C=C/C(=N\C=C(/N)Cl)C(=O)N(C)C.
What is the InChIKey of 2-[(E)-2-amino-2-chloroethenyl]imino-N,N-dimethylbut-3-enamide?
The InChIKey is MHFQQCRFNQAFMD-LAVHUSFLSA-N. The full InChI is InChI=1S/C8H12ClN3O/c1-4-6(8(13)12(2)3)11-5-7(9)10/h4-5H,1,10H2,2-3H3/b7-5-,11-6+.
What are the key properties of 2-[(E)-2-amino-2-chloroethenyl]imino-N,N-dimethylbut-3-enamide?
2-[(E)-2-amino-2-chloroethenyl]imino-N,N-dimethylbut-3-enamide has a molecular weight of 201.66 g/mol, XLogP of 0.70, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(E)-2-amino-2-chloroethenyl]imino-N,N-dimethylbut-3-enamide is sourced from PubChem (CID 88987512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).