About (2R)-1-[(E)-4,4,4-trifluoro-3-methylbut-2-enoxy]but-3-en-2-ol
(2R)-1-[(E)-4,4,4-trifluoro-3-methylbut-2-enoxy]but-3-en-2-ol (PubChem CID 88987836) has the molecular formula C9H13F3O2
and a molecular weight of 210.19 g/mol. Its IUPAC name is (2R)-1-[(E)-4,4,4-trifluoro-3-methylbut-2-enoxy]but-3-en-2-ol.
Molecular Properties
| Compound Name | (2R)-1-[(E)-4,4,4-trifluoro-3-methylbut-2-enoxy]but-3-en-2-ol |
| PubChem CID | 88987836 |
| Molecular Formula | C9H13F3O2 |
| Molecular Weight | 210.19 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | (2R)-1-[(E)-4,4,4-trifluoro-3-methylbut-2-enoxy]but-3-en-2-ol |
| SMILES | C=C[C@@H](O)COC/C=C(\C)C(F)(F)F |
| InChI | InChI=1S/C9H13F3O2/c1-3-8(13)6-14-5-4-7(2)9(10,11)12/h3-4,8,13H,1,5-6H2,2H3/b7-4+/t8-/m1/s1 |
| InChIKey | XFWJTNZRAHWNCS-RXLGXGPVSA-N |
| XLogP | 2.06 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.19 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2R)-1-[(E)-4,4,4-trifluoro-3-methylbut-2-enoxy]but-3-en-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-1-[(E)-4,4,4-trifluoro-3-methylbut-2-enoxy]but-3-en-2-ol?
The IUPAC name of (2R)-1-[(E)-4,4,4-trifluoro-3-methylbut-2-enoxy]but-3-en-2-ol (CID 88987836) is (2R)-1-[(E)-4,4,4-trifluoro-3-methylbut-2-enoxy]but-3-en-2-ol.
What is the SMILES notation for (2R)-1-[(E)-4,4,4-trifluoro-3-methylbut-2-enoxy]but-3-en-2-ol?
The canonical SMILES for (2R)-1-[(E)-4,4,4-trifluoro-3-methylbut-2-enoxy]but-3-en-2-ol is C=C[C@@H](O)COC/C=C(\C)C(F)(F)F.
What is the InChIKey of (2R)-1-[(E)-4,4,4-trifluoro-3-methylbut-2-enoxy]but-3-en-2-ol?
The InChIKey is XFWJTNZRAHWNCS-RXLGXGPVSA-N. The full InChI is InChI=1S/C9H13F3O2/c1-3-8(13)6-14-5-4-7(2)9(10,11)12/h3-4,8,13H,1,5-6H2,2H3/b7-4+/t8-/m1/s1.
What are the key properties of (2R)-1-[(E)-4,4,4-trifluoro-3-methylbut-2-enoxy]but-3-en-2-ol?
(2R)-1-[(E)-4,4,4-trifluoro-3-methylbut-2-enoxy]but-3-en-2-ol has a molecular weight of 210.19 g/mol, XLogP of 2.06, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-1-[(E)-4,4,4-trifluoro-3-methylbut-2-enoxy]but-3-en-2-ol is sourced from PubChem (CID 88987836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).